C34H35F5N2O3 — CID 53344939
3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzamide (PubChem CID 53344939) has the molecular formula C34H35F5N2O3 and a molecular weight of 614.66 g/mol. Its IUPAC name is 3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzamide.
| Compound Name | 3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzamide |
|---|---|
| PubChem CID | 53344939 |
| Molecular Formula | C34H35F5N2O3 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 3-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzamide |
| SMILES | C[C@]12C[C@H](c3ccc(CNc4cccc(C(N)=O)c4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C34H35F5N2O3/c1-31-17-27(20-7-5-19(6-8-20)18-41-23-4-2-3-22(15-23)30(40)43)29-25-12-10-24(42)16-21(25)9-11-26(29)28(31)13-14-32(31,44)33(35,36)34(37,38)39/h2-8,15-16,26-28,41,44H,9-14,17-18H2,1H3,(H2,40,43)/t26?,27-,28?,31+,32+/m1/s1 |
| InChIKey | WKUOBVHTCNVVFP-FMWKCXSCSA-N |
| XLogP | 7.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|