About 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine
5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine (PubChem CID 53345195) has the molecular formula C11H11FN4
and a molecular weight of 218.24 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine |
| PubChem CID | 53345195 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FN4/c1-6-9(10(13)16-11(14)15-6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H4,13,14,15,16) |
| InChIKey | QSERXCKUYFMDAC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine?
The IUPAC name of 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine (CID 53345195) is 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine.
What is the SMILES notation for 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine?
The canonical SMILES for 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine is Cc1nc(N)nc(N)c1-c1ccc(F)cc1.
What is the InChIKey of 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine?
The InChIKey is QSERXCKUYFMDAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN4/c1-6-9(10(13)16-11(14)15-6)7-2-4-8(12)5-3-7/h2-5H,1H3,(H4,13,14,15,16).
What are the key properties of 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine?
5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine has a molecular weight of 218.24 g/mol, XLogP of 1.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluorophenyl)-6-methylpyrimidine-2,4-diamine is sourced from PubChem (CID 53345195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).