About 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine
3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine (PubChem CID 53345248) has the molecular formula C22H24N4O
and a molecular weight of 360.46 g/mol. Its IUPAC name is 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine |
| PubChem CID | 53345248 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine |
| SMILES | CCOc1ccc2cc(-c3nc(C(C)(C)C)n4ccnc(N)c34)ccc2c1 |
| InChI | InChI=1S/C22H24N4O/c1-5-27-17-9-8-14-12-16(7-6-15(14)13-17)18-19-20(23)24-10-11-26(19)21(25-18)22(2,3)4/h6-13H,5H2,1-4H3,(H2,23,24) |
| InChIKey | SORJWXKYZACWJA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine?
The IUPAC name of 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine (CID 53345248) is 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine.
What is the SMILES notation for 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine?
The canonical SMILES for 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine is CCOc1ccc2cc(-c3nc(C(C)(C)C)n4ccnc(N)c34)ccc2c1.
What is the InChIKey of 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine?
The InChIKey is SORJWXKYZACWJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O/c1-5-27-17-9-8-14-12-16(7-6-15(14)13-17)18-19-20(23)24-10-11-26(19)21(25-18)22(2,3)4/h6-13H,5H2,1-4H3,(H2,23,24).
What are the key properties of 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine?
3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine has a molecular weight of 360.46 g/mol, XLogP of 4.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-(6-ethoxynaphthalen-2-yl)imidazo[1,5-a]pyrazin-8-amine is sourced from PubChem (CID 53345248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).