C35H36F5NO3 — CID 53345269
4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-phenylethyl)benzamide (PubChem CID 53345269) has the molecular formula C35H36F5NO3 and a molecular weight of 613.67 g/mol. Its IUPAC name is 4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-phenylethyl)benzamide.
| Compound Name | 4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 53345269 |
| Molecular Formula | C35H36F5NO3 |
| Molecular Weight | 613.67 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]-N-(2-phenylethyl)benzamide |
| SMILES | C[C@]12C[C@H](c3ccc(C(=O)NCCc4ccccc4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H36F5NO3/c1-32-20-28(22-7-9-23(10-8-22)31(43)41-18-16-21-5-3-2-4-6-21)30-26-14-12-25(42)19-24(26)11-13-27(30)29(32)15-17-33(32,44)34(36,37)35(38,39)40/h2-10,19,27-29,44H,11-18,20H2,1H3,(H,41,43)/t27-,28+,29-,32-,33-/m0/s1 |
| InChIKey | BWMVHVWEWVRYBR-IUBAKRFESA-N |
| XLogP | 7.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.67 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|