C29H34F5NO2 — CID 53345273
(11R,13S,17S)-11-[4-[(dimethylamino)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 53345273) has the molecular formula C29H34F5NO2 and a molecular weight of 523.59 g/mol. Its IUPAC name is (11R,13S,17S)-11-[4-[(dimethylamino)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-11-[4-[(dimethylamino)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53345273 |
| Molecular Formula | C29H34F5NO2 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | (11R,13S,17S)-11-[4-[(dimethylamino)methyl]phenyl]-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(C)Cc1ccc([C@H]2C[C@@]3(C)C(CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C29H34F5NO2/c1-26-15-23(18-6-4-17(5-7-18)16-35(2)3)25-21-11-9-20(36)14-19(21)8-10-22(25)24(26)12-13-27(26,37)28(30,31)29(32,33)34/h4-7,14,22-24,37H,8-13,15-16H2,1-3H3/t22?,23-,24?,26+,27+/m1/s1 |
| InChIKey | PPMHNJJSNKJMFL-OMFZNKORSA-N |
| XLogP | 6.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|