C32H39F5N2O2 — CID 53345274
(11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 53345274) has the molecular formula C32H39F5N2O2 and a molecular weight of 578.67 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53345274 |
| Molecular Formula | C32H39F5N2O2 |
| Molecular Weight | 578.67 g/mol |
| Exact Mass | 578.29 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN1CCN(Cc2ccc([C@H]3C[C@@]4(C)C(CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)CC1 |
| InChI | InChI=1S/C32H39F5N2O2/c1-29-18-26(21-5-3-20(4-6-21)19-39-15-13-38(2)14-16-39)28-24-10-8-23(40)17-22(24)7-9-25(28)27(29)11-12-30(29,41)31(33,34)32(35,36)37/h3-6,17,25-27,41H,7-16,18-19H2,1-2H3/t25?,26-,27?,29+,30+/m1/s1 |
| InChIKey | GVUVLGVOIDMZSS-BDQXMMFTSA-N |
| XLogP | 6.26 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|