C34H40F5NO4 — CID 53345388
methyl 1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]piperidine-4-carboxylate (PubChem CID 53345388) has the molecular formula C34H40F5NO4 and a molecular weight of 621.69 g/mol. Its IUPAC name is methyl 1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 53345388 |
| Molecular Formula | C34H40F5NO4 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | methyl 1-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(Cc2ccc([C@H]3C[C@@]4(C)C(CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)CC1 |
| InChI | InChI=1S/C34H40F5NO4/c1-31-18-27(21-5-3-20(4-6-21)19-40-15-12-22(13-16-40)30(42)44-2)29-25-10-8-24(41)17-23(25)7-9-26(29)28(31)11-14-32(31,43)33(35,36)34(37,38)39/h3-6,17,22,26-28,43H,7-16,18-19H2,1-2H3/t26?,27-,28?,31+,32+/m1/s1 |
| InChIKey | UTZLLNVDOLQZLX-FMWKCXSCSA-N |
| XLogP | 6.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|