C31H36F5NO3 — CID 53345390
(11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 53345390) has the molecular formula C31H36F5NO3 and a molecular weight of 565.62 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53345390 |
| Molecular Formula | C31H36F5NO3 |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-(morpholin-4-ylmethyl)phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12C[C@H](c3ccc(CN4CCOCC4)cc3)C3=C4CCC(=O)C=C4CCC3C1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H36F5NO3/c1-28-17-25(20-4-2-19(3-5-20)18-37-12-14-40-15-13-37)27-23-9-7-22(38)16-21(23)6-8-24(27)26(28)10-11-29(28,39)30(32,33)31(34,35)36/h2-5,16,24-26,39H,6-15,17-18H2,1H3/t24?,25-,26?,28+,29+/m1/s1 |
| InChIKey | MBUCETNODKGXLU-YYTJNDDGSA-N |
| XLogP | 6.35 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|