C34H36F5NO3 — CID 53345808
(11R,13S,17S)-17-hydroxy-11-[4-[(2-methoxyanilino)methyl]phenyl]-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 53345808) has the molecular formula C34H36F5NO3 and a molecular weight of 601.66 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-11-[4-[(2-methoxyanilino)methyl]phenyl]-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-11-[4-[(2-methoxyanilino)methyl]phenyl]-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53345808 |
| Molecular Formula | C34H36F5NO3 |
| Molecular Weight | 601.66 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-11-[4-[(2-methoxyanilino)methyl]phenyl]-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | COc1ccccc1NCc1ccc([C@H]2C[C@@]3(C)C(CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C34H36F5NO3/c1-31-18-26(21-9-7-20(8-10-21)19-40-28-5-3-4-6-29(28)43-2)30-24-14-12-23(41)17-22(24)11-13-25(30)27(31)15-16-32(31,42)33(35,36)34(37,38)39/h3-10,17,25-27,40,42H,11-16,18-19H2,1-2H3/t25?,26-,27?,31+,32+/m1/s1 |
| InChIKey | KMVDFBKJLRKZHB-LXXHGADHSA-N |
| XLogP | 8.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.66 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|