C35H36F5NO4 — CID 53345921
methyl 4-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzoate (PubChem CID 53345921) has the molecular formula C35H36F5NO4 and a molecular weight of 629.67 g/mol. Its IUPAC name is methyl 4-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzoate.
| Compound Name | methyl 4-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzoate |
|---|---|
| PubChem CID | 53345921 |
| Molecular Formula | C35H36F5NO4 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.26 |
| IUPAC Name | methyl 4-[[4-[(11R,13S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]methylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCc2ccc([C@H]3C[C@@]4(C)C(CC[C@@]4(O)C(F)(F)C(F)(F)F)C4CCC5=CC(=O)CCC5=C43)cc2)cc1 |
| InChI | InChI=1S/C35H36F5NO4/c1-32-18-28(21-5-3-20(4-6-21)19-41-24-10-7-22(8-11-24)31(43)45-2)30-26-14-12-25(42)17-23(26)9-13-27(30)29(32)15-16-33(32,44)34(36,37)35(38,39)40/h3-8,10-11,17,27-29,41,44H,9,12-16,18-19H2,1-2H3/t27?,28-,29?,32+,33+/m1/s1 |
| InChIKey | LJNDXQVVBLMKIZ-CUIGNWKOSA-N |
| XLogP | 7.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|