C19H23BClF3N4O7 — CID 53345963
[1-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-3-ethoxy-3-oxopropyl]boronic acid (PubChem CID 53345963) has the molecular formula C19H23BClF3N4O7 and a molecular weight of 522.67 g/mol. Its IUPAC name is [1-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-3-ethoxy-3-oxopropyl]boronic acid.
| Compound Name | [1-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-3-ethoxy-3-oxopropyl]boronic acid |
|---|---|
| PubChem CID | 53345963 |
| Molecular Formula | C19H23BClF3N4O7 |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | [1-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-3-ethoxy-3-oxopropyl]boronic acid |
| SMILES | CCOC(=O)CC(NC(=O)C1CCN1C(=O)C(NC(=O)c1ccc(N)c(Cl)c1)C(F)(F)F)B(O)O |
| InChI | InChI=1S/C19H23BClF3N4O7/c1-2-35-14(29)8-13(20(33)34)26-17(31)12-5-6-28(12)18(32)15(19(22,23)24)27-16(30)9-3-4-11(25)10(21)7-9/h3-4,7,12-13,15,33-34H,2,5-6,8,25H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | GQIBXIDSWMKBMH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|