C17H18BClF3N5O5 — CID 53345966
[2-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-2-cyanoethyl]boronic acid (PubChem CID 53345966) has the molecular formula C17H18BClF3N5O5 and a molecular weight of 475.62 g/mol. Its IUPAC name is [2-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-2-cyanoethyl]boronic acid.
| Compound Name | [2-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-2-cyanoethyl]boronic acid |
|---|---|
| PubChem CID | 53345966 |
| Molecular Formula | C17H18BClF3N5O5 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | [2-[[1-[2-[(4-amino-3-chlorobenzoyl)amino]-3,3,3-trifluoropropanoyl]azetidine-2-carbonyl]amino]-2-cyanoethyl]boronic acid |
| SMILES | N#CC(CB(O)O)NC(=O)C1CCN1C(=O)C(NC(=O)c1ccc(N)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C17H18BClF3N5O5/c19-10-5-8(1-2-11(10)24)14(28)26-13(17(20,21)22)16(30)27-4-3-12(27)15(29)25-9(7-23)6-18(31)32/h1-2,5,9,12-13,31-32H,3-4,6,24H2,(H,25,29)(H,26,28) |
| InChIKey | NUIRBNQJUQPUJG-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 168.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|