C22H28N4O — CID 53346018
4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-prop-2-enylpiperazine-1-carboxamide (PubChem CID 53346018) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-prop-2-enylpiperazine-1-carboxamide.
| Compound Name | 4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-prop-2-enylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 53346018 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 4-[(1R,2S)-2-amino-1,2-diphenylethyl]-N-prop-2-enylpiperazine-1-carboxamide |
| SMILES | C=CCNC(=O)N1CCN([C@H](c2ccccc2)[C@@H](N)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N4O/c1-2-13-24-22(27)26-16-14-25(15-17-26)21(19-11-7-4-8-12-19)20(23)18-9-5-3-6-10-18/h2-12,20-21H,1,13-17,23H2,(H,24,27)/t20-,21+/m0/s1 |
| InChIKey | GSQXIHWVOMCHIN-LEWJYISDSA-N |
| XLogP | 2.94 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|