About 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one
3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one (PubChem CID 53346060) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one.
Molecular Properties
| Compound Name | 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one |
| PubChem CID | 53346060 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one |
| SMILES | CCc1ccc(/C(C)=C/[C@H](C)O)oc1=O |
| InChI | InChI=1S/C12H16O3/c1-4-10-5-6-11(15-12(10)14)8(2)7-9(3)13/h5-7,9,13H,4H2,1-3H3/b8-7+/t9-/m0/s1 |
| InChIKey | GCFLNLMFXNZUSH-FLOXNTQESA-N |
| XLogP | 1.99 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one?
The IUPAC name of 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one (CID 53346060) is 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one.
What is the SMILES notation for 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one?
The canonical SMILES for 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one is CCc1ccc(/C(C)=C/[C@H](C)O)oc1=O.
What is the InChIKey of 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one?
The InChIKey is GCFLNLMFXNZUSH-FLOXNTQESA-N. The full InChI is InChI=1S/C12H16O3/c1-4-10-5-6-11(15-12(10)14)8(2)7-9(3)13/h5-7,9,13H,4H2,1-3H3/b8-7+/t9-/m0/s1.
What are the key properties of 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one?
3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one has a molecular weight of 208.26 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-[(E,4S)-4-hydroxypent-2-en-2-yl]pyran-2-one is sourced from PubChem (CID 53346060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).