C34H36F5NO2 — CID 53346462
(11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(N-methylanilino)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 53346462) has the molecular formula C34H36F5NO2 and a molecular weight of 585.66 g/mol. Its IUPAC name is (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(N-methylanilino)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(N-methylanilino)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 53346462 |
| Molecular Formula | C34H36F5NO2 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.27 |
| IUPAC Name | (11R,13S,17S)-17-hydroxy-13-methyl-11-[4-[(N-methylanilino)methyl]phenyl]-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CN(Cc1ccc([C@H]2C[C@@]3(C)C(CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H36F5NO2/c1-31-19-28(22-10-8-21(9-11-22)20-40(2)24-6-4-3-5-7-24)30-26-15-13-25(41)18-23(26)12-14-27(30)29(31)16-17-32(31,42)33(35,36)34(37,38)39/h3-11,18,27-29,42H,12-17,19-20H2,1-2H3/t27?,28-,29?,31+,32+/m1/s1 |
| InChIKey | QGEDKVGIRBFDGV-VWTRGYNXSA-N |
| XLogP | 8.15 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|