About 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine
7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine (PubChem CID 53346506) has the molecular formula C17H18N4O2
and a molecular weight of 310.36 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine.
Molecular Properties
| Compound Name | 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine |
| PubChem CID | 53346506 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine |
| SMILES | COc1ccc(-c2cc3nc(N)nc(N)c3cc2C)cc1OC |
| InChI | InChI=1S/C17H18N4O2/c1-9-6-12-13(20-17(19)21-16(12)18)8-11(9)10-4-5-14(22-2)15(7-10)23-3/h4-8H,1-3H3,(H4,18,19,20,21) |
| InChIKey | UGJMRAQTQALEME-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine?
The IUPAC name of 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine (CID 53346506) is 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine.
What is the SMILES notation for 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine?
The canonical SMILES for 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine is COc1ccc(-c2cc3nc(N)nc(N)c3cc2C)cc1OC.
What is the InChIKey of 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine?
The InChIKey is UGJMRAQTQALEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2/c1-9-6-12-13(20-17(19)21-16(12)18)8-11(9)10-4-5-14(22-2)15(7-10)23-3/h4-8H,1-3H3,(H4,18,19,20,21).
What are the key properties of 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine?
7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine has a molecular weight of 310.36 g/mol, XLogP of 2.79, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-dimethoxyphenyl)-6-methylquinazoline-2,4-diamine is sourced from PubChem (CID 53346506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).