C19H28ClN2O- — CID 53347611
N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ylacetamide chloride (PubChem CID 53347611) has the molecular formula C19H28ClN2O- and a molecular weight of 335.90 g/mol. Its IUPAC name is N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ylacetamide chloride.
| Compound Name | N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ylacetamide chloride |
|---|---|
| PubChem CID | 53347611 |
| Molecular Formula | C19H28ClN2O- |
| Molecular Weight | 335.90 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | N-[(1-phenylcyclopentyl)methyl]-2-piperidin-1-ylacetamide chloride |
| SMILES | O=C(CN1CCCCC1)NCC1(c2ccccc2)CCCC1.[Cl-] |
| InChI | InChI=1S/C19H28N2O.ClH/c22-18(15-21-13-7-2-8-14-21)20-16-19(11-5-6-12-19)17-9-3-1-4-10-17;/h1,3-4,9-10H,2,5-8,11-16H2,(H,20,22);1H/p-1 |
| InChIKey | USCWFBVSLYTGIS-UHFFFAOYSA-M |
| XLogP | 0.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.90 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |