C25H17F3N4O2S — CID 53348080
N-[2-methyl-4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide (PubChem CID 53348080) has the molecular formula C25H17F3N4O2S and a molecular weight of 494.50 g/mol. Its IUPAC name is N-[2-methyl-4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide.
| Compound Name | N-[2-methyl-4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 53348080 |
| Molecular Formula | C25H17F3N4O2S |
| Molecular Weight | 494.50 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | N-[2-methyl-4-[[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cccc(C(F)(F)F)c2)ccc1NC(=O)c1cc2cnc3[nH]ccc3c2s1 |
| InChI | InChI=1S/C25H17F3N4O2S/c1-13-9-17(31-23(33)14-3-2-4-16(10-14)25(26,27)28)5-6-19(13)32-24(34)20-11-15-12-30-22-18(7-8-29-22)21(15)35-20/h2-12H,1H3,(H,29,30)(H,31,33)(H,32,34) |
| InChIKey | SCKQRMLJVAOJJT-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.50 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |