C26H19F3N4O2S — CID 53348082
N-[2-methyl-4-[methyl-[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide (PubChem CID 53348082) has the molecular formula C26H19F3N4O2S and a molecular weight of 508.53 g/mol. Its IUPAC name is N-[2-methyl-4-[methyl-[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide.
| Compound Name | N-[2-methyl-4-[methyl-[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
|---|---|
| PubChem CID | 53348082 |
| Molecular Formula | C26H19F3N4O2S |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N-[2-methyl-4-[methyl-[3-(trifluoromethyl)benzoyl]amino]phenyl]-3-thia-8,10-diazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-4-carboxamide |
| SMILES | Cc1cc(N(C)C(=O)c2cccc(C(F)(F)F)c2)ccc1NC(=O)c1cc2cnc3[nH]ccc3c2s1 |
| InChI | InChI=1S/C26H19F3N4O2S/c1-14-10-18(33(2)25(35)15-4-3-5-17(11-15)26(27,28)29)6-7-20(14)32-24(34)21-12-16-13-31-23-19(8-9-30-23)22(16)36-21/h3-13H,1-2H3,(H,30,31)(H,32,34) |
| InChIKey | JCCCWWPUJQITMY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |