C19H14BrNO4S2 — CID 53348089
2-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 53348089) has the molecular formula C19H14BrNO4S2 and a molecular weight of 464.36 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 2-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 53348089 |
| Molecular Formula | C19H14BrNO4S2 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | 2-[(5E)-5-[(3-bromophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc(O)cc1)N1C(=O)/C(=C\c2cccc(Br)c2)SC1=S |
| InChI | InChI=1S/C19H14BrNO4S2/c20-13-3-1-2-12(8-13)10-16-17(23)21(19(26)27-16)15(18(24)25)9-11-4-6-14(22)7-5-11/h1-8,10,15,22H,9H2,(H,24,25)/b16-10+ |
| InChIKey | GKKWLAWEKPVWCI-MHWRWJLKSA-N |
| XLogP | 4.05 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|