C30H24FN5O2 — CID 53348181
2-[[4-amino-3-(3-fluoro-5-hydroxyphenyl)indazol-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one (PubChem CID 53348181) has the molecular formula C30H24FN5O2 and a molecular weight of 505.55 g/mol. Its IUPAC name is 2-[[4-amino-3-(3-fluoro-5-hydroxyphenyl)indazol-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one.
| Compound Name | 2-[[4-amino-3-(3-fluoro-5-hydroxyphenyl)indazol-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 53348181 |
| Molecular Formula | C30H24FN5O2 |
| Molecular Weight | 505.55 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 2-[[4-amino-3-(3-fluoro-5-hydroxyphenyl)indazol-1-yl]methyl]-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| SMILES | Cc1ccccc1-n1c(Cn2nc(-c3cc(O)cc(F)c3)c3c(N)cccc32)nc2cccc(C)c2c1=O |
| InChI | InChI=1S/C30H24FN5O2/c1-17-7-3-4-11-24(17)36-26(33-23-10-5-8-18(2)27(23)30(36)38)16-35-25-12-6-9-22(32)28(25)29(34-35)19-13-20(31)15-21(37)14-19/h3-15,37H,16,32H2,1-2H3 |
| InChIKey | IFJYYBZHFXCMOD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|