C22H30O3 — CID 53348239
[(1S,8R,9S,11S,12R,15R,16R)-1,5,9,16-tetramethyl-14-oxo-11-tetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dienyl] acetate (PubChem CID 53348239) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(1S,8R,9S,11S,12R,15R,16R)-1,5,9,16-tetramethyl-14-oxo-11-tetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dienyl] acetate.
| Compound Name | [(1S,8R,9S,11S,12R,15R,16R)-1,5,9,16-tetramethyl-14-oxo-11-tetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dienyl] acetate |
|---|---|
| PubChem CID | 53348239 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(1S,8R,9S,11S,12R,15R,16R)-1,5,9,16-tetramethyl-14-oxo-11-tetracyclo[6.6.2.04,15.012,16]hexadeca-3,5-dienyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](C)[C@H]2CC=C(C)C3=CC[C@]4(C)C(=O)C[C@@H]1[C@@]2(C)[C@H]34 |
| InChI | InChI=1S/C22H30O3/c1-12-6-7-16-13(2)10-18(25-14(3)23)17-11-19(24)21(4)9-8-15(12)20(21)22(16,17)5/h6,8,13,16-18,20H,7,9-11H2,1-5H3/t13-,16+,17-,18-,20+,21+,22-/m0/s1 |
| InChIKey | IUBCDTFREQUAAM-HAVWPOOFSA-N |
| XLogP | 4.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |