C15H17ClO4S — CID 53348310
(E)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylprop-2-enoic acid (PubChem CID 53348310) has the molecular formula C15H17ClO4S and a molecular weight of 328.82 g/mol. Its IUPAC name is (E)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylprop-2-enoic acid.
| Compound Name | (E)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylprop-2-enoic acid |
|---|---|
| PubChem CID | 53348310 |
| Molecular Formula | C15H17ClO4S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (E)-2-(3-chloro-4-methylsulfonylphenyl)-3-cyclopentylprop-2-enoic acid |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\C2CCCC2)C(=O)O)cc1Cl |
| InChI | InChI=1S/C15H17ClO4S/c1-21(19,20)14-7-6-11(9-13(14)16)12(15(17)18)8-10-4-2-3-5-10/h6-10H,2-5H2,1H3,(H,17,18)/b12-8+ |
| InChIKey | HVFCNPXKNFPRKG-XYOKQWHBSA-N |
| XLogP | 3.40 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|