C30H50O2Si — CID 53348340
[(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-7-prop-2-enoxy-5-prop-1-ynyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 53348340) has the molecular formula C30H50O2Si and a molecular weight of 470.81 g/mol. Its IUPAC name is [(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-7-prop-2-enoxy-5-prop-1-ynyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-7-prop-2-enoxy-5-prop-1-ynyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 53348340 |
| Molecular Formula | C30H50O2Si |
| Molecular Weight | 470.81 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | [(1S,3S,4R,4aR,5R,8aR)-3,4a,6-trimethyl-4-(3-methylbut-2-enyl)-7-prop-2-enoxy-5-prop-1-ynyl-2,3,4,5,8,8a-hexahydro-1H-naphthalen-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CCOC1=C(C)[C@@H](C#CC)[C@@]2(C)[C@H](CC=C(C)C)[C@@H](C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C30H50O2Si/c1-13-15-25-23(6)27(31-18-14-2)20-26-28(32-33(11,12)29(7,8)9)19-22(5)24(30(25,26)10)17-16-21(3)4/h14,16,22,24-26,28H,2,17-20H2,1,3-12H3/t22-,24+,25+,26-,28-,30+/m0/s1 |
| InChIKey | IEAKKISWFMSEPZ-LGOHERATSA-N |
| XLogP | 8.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.81 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|