About S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate
S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate (PubChem CID 53348754) has the molecular formula C10H19NO3S
and a molecular weight of 233.33 g/mol. Its IUPAC name is S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate |
| PubChem CID | 53348754 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate |
| SMILES | CC[C@H](O)[C@H](C)C(=O)SCCNC(C)=O |
| InChI | InChI=1S/C10H19NO3S/c1-4-9(13)7(2)10(14)15-6-5-11-8(3)12/h7,9,13H,4-6H2,1-3H3,(H,11,12)/t7-,9-/m0/s1 |
| InChIKey | OFOFOJMLEBUWJQ-CBAPKCEASA-N |
| XLogP | 0.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate?
The IUPAC name of S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate (CID 53348754) is S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate.
What is the SMILES notation for S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate?
The canonical SMILES for S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate is CC[C@H](O)[C@H](C)C(=O)SCCNC(C)=O.
What is the InChIKey of S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate?
The InChIKey is OFOFOJMLEBUWJQ-CBAPKCEASA-N. The full InChI is InChI=1S/C10H19NO3S/c1-4-9(13)7(2)10(14)15-6-5-11-8(3)12/h7,9,13H,4-6H2,1-3H3,(H,11,12)/t7-,9-/m0/s1.
What are the key properties of S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate?
S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate has a molecular weight of 233.33 g/mol, XLogP of 0.79, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) (2S,3S)-3-hydroxy-2-methylpentanethioate is sourced from PubChem (CID 53348754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).