About 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+)
2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) (PubChem CID 53348953) has the molecular formula C17H26N2O4Pt
and a molecular weight of 517.48 g/mol. Its IUPAC name is 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+).
Molecular Properties
| Compound Name | 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) |
| PubChem CID | 53348953 |
| Molecular Formula | C17H26N2O4Pt |
| Molecular Weight | 517.48 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) |
| SMILES | CCOCC(=O)[O-].N[C@@H]1CCCC[C@H]1NCc1ccccc1[O-].[Pt+2] |
| InChI | InChI=1S/C13H20N2O.C4H8O3.Pt/c14-11-6-2-3-7-12(11)15-9-10-5-1-4-8-13(10)16;1-2-7-3-4(5)6;/h1,4-5,8,11-12,15-16H,2-3,6-7,9,14H2;2-3H2,1H3,(H,5,6);/q;;+2/p-2/t11-,12-;;/m1../s1 |
| InChIKey | RXNPVAFLVYKAAD-MBORUXJMSA-L |
| XLogP | -0.11 |
| TPSA | 110.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 517.48 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+)?
The IUPAC name of 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) (CID 53348953) is 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+).
What is the SMILES notation for 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+)?
The canonical SMILES for 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) is CCOCC(=O)[O-].N[C@@H]1CCCC[C@H]1NCc1ccccc1[O-].[Pt+2].
What is the InChIKey of 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+)?
The InChIKey is RXNPVAFLVYKAAD-MBORUXJMSA-L. The full InChI is InChI=1S/C13H20N2O.C4H8O3.Pt/c14-11-6-2-3-7-12(11)15-9-10-5-1-4-8-13(10)16;1-2-7-3-4(5)6;/h1,4-5,8,11-12,15-16H,2-3,6-7,9,14H2;2-3H2,1H3,(H,5,6);/q;;+2/p-2/t11-,12-;;/m1../s1.
What are the key properties of 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+)?
2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) has a molecular weight of 517.48 g/mol, XLogP of -0.11, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[[(1R,2R)-2-aminocyclohexyl]amino]methyl]phenolate;2-ethoxyacetate;platinum(2+) is sourced from PubChem (CID 53348953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).