C18H28O3 — CID 53348970
(E,9S,16R)-octadec-10-en-12,14-diyne-1,9,16-triol (PubChem CID 53348970) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (E,9S,16R)-octadec-10-en-12,14-diyne-1,9,16-triol.
| Compound Name | (E,9S,16R)-octadec-10-en-12,14-diyne-1,9,16-triol |
|---|---|
| PubChem CID | 53348970 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (E,9S,16R)-octadec-10-en-12,14-diyne-1,9,16-triol |
| SMILES | CC[C@@H](O)C#CC#C/C=C/[C@@H](O)CCCCCCCCO |
| InChI | InChI=1S/C18H28O3/c1-2-17(20)13-9-6-7-11-15-18(21)14-10-5-3-4-8-12-16-19/h11,15,17-21H,2-5,8,10,12,14,16H2,1H3/b15-11+/t17-,18+/m1/s1 |
| InChIKey | CJWSTQBYJWFAJS-CJOJLPBESA-N |
| XLogP | 2.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|