C20H30O4 — CID 53348971
[(E,9S,16R)-9,16-dihydroxyoctadec-10-en-12,14-diynyl] acetate (PubChem CID 53348971) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is [(E,9S,16R)-9,16-dihydroxyoctadec-10-en-12,14-diynyl] acetate.
| Compound Name | [(E,9S,16R)-9,16-dihydroxyoctadec-10-en-12,14-diynyl] acetate |
|---|---|
| PubChem CID | 53348971 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [(E,9S,16R)-9,16-dihydroxyoctadec-10-en-12,14-diynyl] acetate |
| SMILES | CC[C@@H](O)C#CC#C/C=C/[C@@H](O)CCCCCCCCOC(C)=O |
| InChI | InChI=1S/C20H30O4/c1-3-19(22)14-10-7-8-12-16-20(23)15-11-6-4-5-9-13-17-24-18(2)21/h12,16,19-20,22-23H,3-6,9,11,13,15,17H2,1-2H3/b16-12+/t19-,20+/m1/s1 |
| InChIKey | AOKHCWHJBDFVGB-PZBSJLNOSA-N |
| XLogP | 2.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|