About tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate
tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate (PubChem CID 53349204) has the molecular formula C20H28BrNO4
and a molecular weight of 426.35 g/mol. Its IUPAC name is tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate |
| PubChem CID | 53349204 |
| Molecular Formula | C20H28BrNO4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate |
| SMILES | COc1cc(Br)c(CN(C(=O)OC(C)(C)C)C2C=CCCC2)cc1OC |
| InChI | InChI=1S/C20H28BrNO4/c1-20(2,3)26-19(23)22(15-9-7-6-8-10-15)13-14-11-17(24-4)18(25-5)12-16(14)21/h7,9,11-12,15H,6,8,10,13H2,1-5H3 |
| InChIKey | AFYMIKUKWYHPMO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate?
The IUPAC name of tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate (CID 53349204) is tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate.
What is the SMILES notation for tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate?
The canonical SMILES for tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate is COc1cc(Br)c(CN(C(=O)OC(C)(C)C)C2C=CCCC2)cc1OC.
What is the InChIKey of tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate?
The InChIKey is AFYMIKUKWYHPMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H28BrNO4/c1-20(2,3)26-19(23)22(15-9-7-6-8-10-15)13-14-11-17(24-4)18(25-5)12-16(14)21/h7,9,11-12,15H,6,8,10,13H2,1-5H3.
What are the key properties of tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate?
tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate has a molecular weight of 426.35 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(2-bromo-4,5-dimethoxyphenyl)methyl]-N-cyclohex-2-en-1-ylcarbamate is sourced from PubChem (CID 53349204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).