C42H48ClO4P — CID 53349619
tributyl-[(1Z,3E)-1,4-dibenzoyloxy-1,4-diphenylbuta-1,3-dien-2-yl]phosphanium chloride (PubChem CID 53349619) has the molecular formula C42H48ClO4P and a molecular weight of 683.27 g/mol. Its IUPAC name is tributyl-[(1Z,3E)-1,4-dibenzoyloxy-1,4-diphenylbuta-1,3-dien-2-yl]phosphanium chloride.
| Compound Name | tributyl-[(1Z,3E)-1,4-dibenzoyloxy-1,4-diphenylbuta-1,3-dien-2-yl]phosphanium chloride |
|---|---|
| PubChem CID | 53349619 |
| Molecular Formula | C42H48ClO4P |
| Molecular Weight | 683.27 g/mol |
| Exact Mass | 682.30 |
| IUPAC Name | tributyl-[(1Z,3E)-1,4-dibenzoyloxy-1,4-diphenylbuta-1,3-dien-2-yl]phosphanium chloride |
| SMILES | CCCC[P+](CCCC)(CCCC)C(/C=C(/OC(=O)c1ccccc1)c1ccccc1)=C(\OC(=O)c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C42H48O4P.ClH/c1-4-7-30-47(31-8-5-2,32-9-6-3)39(40(35-24-16-11-17-25-35)46-42(44)37-28-20-13-21-29-37)33-38(34-22-14-10-15-23-34)45-41(43)36-26-18-12-19-27-36;/h10-29,33H,4-9,30-32H2,1-3H3;1H/q+1;/p-1/b38-33+,40-39-; |
| InChIKey | YDGORZBCSADTIA-MYFJWISKSA-M |
| XLogP | 8.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.27 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|