C16H26Cl2N2O2 — CID 53349627
3-(dimethylamino)-1-[3-[3-(dimethylamino)propanoyl]phenyl]propan-1-one;dihydrochloride (PubChem CID 53349627) has the molecular formula C16H26Cl2N2O2 and a molecular weight of 349.30 g/mol. Its IUPAC name is 3-(dimethylamino)-1-[3-[3-(dimethylamino)propanoyl]phenyl]propan-1-one;dihydrochloride.
| Compound Name | 3-(dimethylamino)-1-[3-[3-(dimethylamino)propanoyl]phenyl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 53349627 |
| Molecular Formula | C16H26Cl2N2O2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-(dimethylamino)-1-[3-[3-(dimethylamino)propanoyl]phenyl]propan-1-one;dihydrochloride |
| SMILES | CN(C)CCC(=O)c1cccc(C(=O)CCN(C)C)c1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O2.2ClH/c1-17(2)10-8-15(19)13-6-5-7-14(12-13)16(20)9-11-18(3)4;;/h5-7,12H,8-11H2,1-4H3;2*1H |
| InChIKey | HLVMHFJDFSXKHN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |