About [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate
[3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate (PubChem CID 5334968) has the molecular formula C20H14BrN3O3
and a molecular weight of 424.25 g/mol. Its IUPAC name is [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate.
Molecular Properties
| Compound Name | [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate |
| PubChem CID | 5334968 |
| Molecular Formula | C20H14BrN3O3 |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 423.02 |
| IUPAC Name | [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate |
| SMILES | O=C(N/N=C/c1cccc(OC(=O)c2cccc(Br)c2)c1)c1ccncc1 |
| InChI | InChI=1S/C20H14BrN3O3/c21-17-5-2-4-16(12-17)20(26)27-18-6-1-3-14(11-18)13-23-24-19(25)15-7-9-22-10-8-15/h1-13H,(H,24,25)/b23-13+ |
| InChIKey | JDYPNLSNVMKDSV-YDZHTSKRSA-N |
| XLogP | 3.83 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate?
The IUPAC name of [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate (CID 5334968) is [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate.
What is the SMILES notation for [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate?
The canonical SMILES for [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate is O=C(N/N=C/c1cccc(OC(=O)c2cccc(Br)c2)c1)c1ccncc1.
What is the InChIKey of [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate?
The InChIKey is JDYPNLSNVMKDSV-YDZHTSKRSA-N. The full InChI is InChI=1S/C20H14BrN3O3/c21-17-5-2-4-16(12-17)20(26)27-18-6-1-3-14(11-18)13-23-24-19(25)15-7-9-22-10-8-15/h1-13H,(H,24,25)/b23-13+.
What are the key properties of [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate?
[3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate has a molecular weight of 424.25 g/mol, XLogP of 3.83, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(E)-(pyridine-4-carbonylhydrazinylidene)methyl]phenyl] 3-bromobenzoate is sourced from PubChem (CID 5334968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).