C11H8ClN5OS — CID 53349684
2-chloro-N-(pyrimidin-2-ylcarbamothioyl)pyridine-3-carboxamide (PubChem CID 53349684) has the molecular formula C11H8ClN5OS and a molecular weight of 293.74 g/mol. Its IUPAC name is 2-chloro-N-(pyrimidin-2-ylcarbamothioyl)pyridine-3-carboxamide.
| Compound Name | 2-chloro-N-(pyrimidin-2-ylcarbamothioyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 53349684 |
| Molecular Formula | C11H8ClN5OS |
| Molecular Weight | 293.74 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 2-chloro-N-(pyrimidin-2-ylcarbamothioyl)pyridine-3-carboxamide |
| SMILES | O=C(NC(=S)Nc1ncccn1)c1cccnc1Cl |
| InChI | InChI=1S/C11H8ClN5OS/c12-8-7(3-1-4-13-8)9(18)16-11(19)17-10-14-5-2-6-15-10/h1-6H,(H2,14,15,16,17,18,19) |
| InChIKey | JVVGJOCOCVSVTO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.74 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|