C6H10N4 — CID 533498
3,6-diethyl-1,2,4,5-tetrazine (PubChem CID 533498) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 3,6-diethyl-1,2,4,5-tetrazine.
| Compound Name | 3,6-diethyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 533498 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 3,6-diethyl-1,2,4,5-tetrazine |
| SMILES | CCc1nnc(CC)nn1 |
| InChI | InChI=1S/C6H10N4/c1-3-5-7-9-6(4-2)10-8-5/h3-4H2,1-2H3 |
| InChIKey | FJLNLVDWWLZFIP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |