About 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole
9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole (PubChem CID 53349834) has the molecular formula C34H21NO2S4
and a molecular weight of 603.82 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole |
| PubChem CID | 53349834 |
| Molecular Formula | C34H21NO2S4 |
| Molecular Weight | 603.82 g/mol |
| Exact Mass | 603.05 |
| IUPAC Name | 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole |
| SMILES | O=S(=O)(c1ccccc1)n1c2ccccc2c2cc3cc(-c4cc(-c5cccs5)cc(-c5cccs5)c4)sc3cc21 |
| InChI | InChI=1S/C34H21NO2S4/c36-41(37,26-8-2-1-3-9-26)35-29-11-5-4-10-27(29)28-19-25-20-33(40-34(25)21-30(28)35)24-17-22(31-12-6-14-38-31)16-23(18-24)32-13-7-15-39-32/h1-21H |
| InChIKey | GINMBEXPYQKLGB-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.82 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole?
The IUPAC name of 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole (CID 53349834) is 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole.
What is the SMILES notation for 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole?
The canonical SMILES for 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole is O=S(=O)(c1ccccc1)n1c2ccccc2c2cc3cc(-c4cc(-c5cccs5)cc(-c5cccs5)c4)sc3cc21.
What is the InChIKey of 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole?
The InChIKey is GINMBEXPYQKLGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H21NO2S4/c36-41(37,26-8-2-1-3-9-26)35-29-11-5-4-10-27(29)28-19-25-20-33(40-34(25)21-30(28)35)24-17-22(31-12-6-14-38-31)16-23(18-24)32-13-7-15-39-32/h1-21H.
What are the key properties of 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole?
9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole has a molecular weight of 603.82 g/mol, XLogP of 10.37, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-2-(3,5-dithiophen-2-ylphenyl)thieno[2,3-b]carbazole is sourced from PubChem (CID 53349834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).