About 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine
4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine (PubChem CID 53349974) has the molecular formula C11H4BrF4NS
and a molecular weight of 338.12 g/mol. Its IUPAC name is 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine.
Molecular Properties
| Compound Name | 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine |
| PubChem CID | 53349974 |
| Molecular Formula | C11H4BrF4NS |
| Molecular Weight | 338.12 g/mol |
| Exact Mass | 336.92 |
| IUPAC Name | 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine |
| SMILES | Fc1nc(F)c(F)c(Sc2ccccc2Br)c1F |
| InChI | InChI=1S/C11H4BrF4NS/c12-5-3-1-2-4-6(5)18-9-7(13)10(15)17-11(16)8(9)14/h1-4H |
| InChIKey | ALYJZUQWPBMDFA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.12 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine?
The IUPAC name of 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine (CID 53349974) is 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine.
What is the SMILES notation for 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine?
The canonical SMILES for 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine is Fc1nc(F)c(F)c(Sc2ccccc2Br)c1F.
What is the InChIKey of 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine?
The InChIKey is ALYJZUQWPBMDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H4BrF4NS/c12-5-3-1-2-4-6(5)18-9-7(13)10(15)17-11(16)8(9)14/h1-4H.
What are the key properties of 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine?
4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine has a molecular weight of 338.12 g/mol, XLogP of 4.55, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromophenyl)sulfanyl-2,3,5,6-tetrafluoropyridine is sourced from PubChem (CID 53349974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).