C18H8Br2F4S2 — CID 53349981
1,4-bis[(2-bromophenyl)sulfanyl]-2,3,5,6-tetrafluorobenzene (PubChem CID 53349981) has the molecular formula C18H8Br2F4S2 and a molecular weight of 524.20 g/mol. Its IUPAC name is 1,4-bis[(2-bromophenyl)sulfanyl]-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1,4-bis[(2-bromophenyl)sulfanyl]-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 53349981 |
| Molecular Formula | C18H8Br2F4S2 |
| Molecular Weight | 524.20 g/mol |
| Exact Mass | 521.84 |
| IUPAC Name | 1,4-bis[(2-bromophenyl)sulfanyl]-2,3,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(Sc2ccccc2Br)c(F)c(F)c1Sc1ccccc1Br |
| InChI | InChI=1S/C18H8Br2F4S2/c19-9-5-1-3-7-11(9)25-17-13(21)15(23)18(16(24)14(17)22)26-12-8-4-2-6-10(12)20/h1-8H |
| InChIKey | SWLDCYNYAIFOGC-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.20 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|