C16H18IN — CID 53350134
2,2,3-trimethyl-1H-benzo[f]isoquinolin-3-ium iodide (PubChem CID 53350134) has the molecular formula C16H18IN and a molecular weight of 351.23 g/mol. Its IUPAC name is 2,2,3-trimethyl-1H-benzo[f]isoquinolin-3-ium iodide.
| Compound Name | 2,2,3-trimethyl-1H-benzo[f]isoquinolin-3-ium iodide |
|---|---|
| PubChem CID | 53350134 |
| Molecular Formula | C16H18IN |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2,2,3-trimethyl-1H-benzo[f]isoquinolin-3-ium iodide |
| SMILES | C[N+]1=Cc2ccc3ccccc3c2CC1(C)C.[I-] |
| InChI | InChI=1S/C16H18N.HI/c1-16(2)10-15-13(11-17(16)3)9-8-12-6-4-5-7-14(12)15;/h4-9,11H,10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZYZHLOOFJMQRNO-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|