C14H10ClN3O3 — CID 5335030
N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide (PubChem CID 5335030) has the molecular formula C14H10ClN3O3 and a molecular weight of 303.70 g/mol. Its IUPAC name is N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 5335030 |
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-[(E)-(6-chloro-1,3-benzodioxol-5-yl)methylideneamino]pyridine-2-carboxamide |
| SMILES | O=C(N/N=C/c1cc2c(cc1Cl)OCO2)c1ccccn1 |
| InChI | InChI=1S/C14H10ClN3O3/c15-10-6-13-12(20-8-21-13)5-9(10)7-17-18-14(19)11-3-1-2-4-16-11/h1-7H,8H2,(H,18,19)/b17-7+ |
| InChIKey | ZZPIVQSZUKYZOJ-REZTVBANSA-N |
| XLogP | 2.23 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|