About [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide
[2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide (PubChem CID 53350626) has the molecular formula C7H14BrN4S2-
and a molecular weight of 298.26 g/mol. Its IUPAC name is [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide.
Molecular Properties
| Compound Name | [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide |
| PubChem CID | 53350626 |
| Molecular Formula | C7H14BrN4S2- |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide |
| SMILES | [Br-].[H]/N=C(\N)SCC1CN=C(N(C)C)S1 |
| InChI | InChI=1S/C7H14N4S2.BrH/c1-11(2)7-10-3-5(13-7)4-12-6(8)9;/h5H,3-4H2,1-2H3,(H3,8,9);1H/p-1 |
| InChIKey | XYTMESHSACTYOU-UHFFFAOYSA-M |
| XLogP | -2.35 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide?
The IUPAC name of [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide (CID 53350626) is [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide.
What is the SMILES notation for [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide?
The canonical SMILES for [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide is [Br-].[H]/N=C(\N)SCC1CN=C(N(C)C)S1.
What is the InChIKey of [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide?
The InChIKey is XYTMESHSACTYOU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14N4S2.BrH/c1-11(2)7-10-3-5(13-7)4-12-6(8)9;/h5H,3-4H2,1-2H3,(H3,8,9);1H/p-1.
What are the key properties of [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide?
[2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide has a molecular weight of 298.26 g/mol, XLogP of -2.35, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(dimethylamino)-4,5-dihydro-1,3-thiazol-5-yl]methyl carbamimidothioate bromide is sourced from PubChem (CID 53350626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).