About methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide
methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide (PubChem CID 53350757) has the molecular formula C13H15BrN3O2-
and a molecular weight of 325.19 g/mol. Its IUPAC name is methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide.
Molecular Properties
| Compound Name | methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide |
| PubChem CID | 53350757 |
| Molecular Formula | C13H15BrN3O2- |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide |
| SMILES | COC(=O)CN1C2=NCCCN2c2ccccc21.[Br-] |
| InChI | InChI=1S/C13H15N3O2.BrH/c1-18-12(17)9-16-11-6-3-2-5-10(11)15-8-4-7-14-13(15)16;/h2-3,5-6H,4,7-9H2,1H3;1H/p-1 |
| InChIKey | NQHKMXWTXVTIGN-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide?
The IUPAC name of methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide (CID 53350757) is methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide.
What is the SMILES notation for methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide?
The canonical SMILES for methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide is COC(=O)CN1C2=NCCCN2c2ccccc21.[Br-].
What is the InChIKey of methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide?
The InChIKey is NQHKMXWTXVTIGN-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H15N3O2.BrH/c1-18-12(17)9-16-11-6-3-2-5-10(11)15-8-4-7-14-13(15)16;/h2-3,5-6H,4,7-9H2,1H3;1H/p-1.
What are the key properties of methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide?
methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide has a molecular weight of 325.19 g/mol, XLogP of -1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(3,4-dihydro-2H-pyrimido[1,2-a]benzimidazol-10-yl)acetate bromide is sourced from PubChem (CID 53350757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).