C21H22ClN2O2- — CID 53350927
N-[(3-methoxy-2-phenylmethoxyphenyl)methyl]-1-pyridin-3-ylmethanamine chloride (PubChem CID 53350927) has the molecular formula C21H22ClN2O2- and a molecular weight of 369.87 g/mol. Its IUPAC name is N-[(3-methoxy-2-phenylmethoxyphenyl)methyl]-1-pyridin-3-ylmethanamine chloride.
| Compound Name | N-[(3-methoxy-2-phenylmethoxyphenyl)methyl]-1-pyridin-3-ylmethanamine chloride |
|---|---|
| PubChem CID | 53350927 |
| Molecular Formula | C21H22ClN2O2- |
| Molecular Weight | 369.87 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | N-[(3-methoxy-2-phenylmethoxyphenyl)methyl]-1-pyridin-3-ylmethanamine chloride |
| SMILES | COc1cccc(CNCc2cccnc2)c1OCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C21H22N2O2.ClH/c1-24-20-11-5-10-19(15-23-14-18-9-6-12-22-13-18)21(20)25-16-17-7-3-2-4-8-17;/h2-13,23H,14-16H2,1H3;1H/p-1 |
| InChIKey | QKXDMBTVLRUOPJ-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.87 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |