About 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride
1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride (PubChem CID 53351014) has the molecular formula C13H17Cl3N3-
and a molecular weight of 321.66 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride.
Molecular Properties
| Compound Name | 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride |
| PubChem CID | 53351014 |
| Molecular Formula | C13H17Cl3N3- |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride |
| SMILES | CC(=NN1CCN(C)CC1)c1ccc(Cl)c(Cl)c1.[Cl-] |
| InChI | InChI=1S/C13H17Cl2N3.ClH/c1-10(11-3-4-12(14)13(15)9-11)16-18-7-5-17(2)6-8-18;/h3-4,9H,5-8H2,1-2H3;1H/p-1 |
| InChIKey | RWHWMBNBSJQPRN-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride?
The IUPAC name of 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride (CID 53351014) is 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride.
What is the SMILES notation for 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride?
The canonical SMILES for 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride is CC(=NN1CCN(C)CC1)c1ccc(Cl)c(Cl)c1.[Cl-].
What is the InChIKey of 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride?
The InChIKey is RWHWMBNBSJQPRN-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H17Cl2N3.ClH/c1-10(11-3-4-12(14)13(15)9-11)16-18-7-5-17(2)6-8-18;/h3-4,9H,5-8H2,1-2H3;1H/p-1.
What are the key properties of 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride?
1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride has a molecular weight of 321.66 g/mol, XLogP of -0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dichlorophenyl)-N-(4-methylpiperazin-1-yl)ethanimine chloride is sourced from PubChem (CID 53351014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).