About 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride
2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride (PubChem CID 53351738) has the molecular formula C16H14Cl3N4O-
and a molecular weight of 384.67 g/mol. Its IUPAC name is 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride.
Molecular Properties
| Compound Name | 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride |
| PubChem CID | 53351738 |
| Molecular Formula | C16H14Cl3N4O- |
| Molecular Weight | 384.67 g/mol |
| Exact Mass | 383.02 |
| IUPAC Name | 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride |
| SMILES | OCCNc1nc(Nc2ccc(Cl)c(Cl)c2)nc2ccccc12.[Cl-] |
| InChI | InChI=1S/C16H14Cl2N4O.ClH/c17-12-6-5-10(9-13(12)18)20-16-21-14-4-2-1-3-11(14)15(22-16)19-7-8-23;/h1-6,9,23H,7-8H2,(H2,19,20,21,22);1H/p-1 |
| InChIKey | PPVDDFIZJMWKLM-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.67 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride?
The IUPAC name of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride (CID 53351738) is 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride.
What is the SMILES notation for 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride?
The canonical SMILES for 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride is OCCNc1nc(Nc2ccc(Cl)c(Cl)c2)nc2ccccc12.[Cl-].
What is the InChIKey of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride?
The InChIKey is PPVDDFIZJMWKLM-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H14Cl2N4O.ClH/c17-12-6-5-10(9-13(12)18)20-16-21-14-4-2-1-3-11(14)15(22-16)19-7-8-23;/h1-6,9,23H,7-8H2,(H2,19,20,21,22);1H/p-1.
What are the key properties of 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride?
2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride has a molecular weight of 384.67 g/mol, XLogP of 1.09, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,4-dichloroanilino)quinazolin-4-yl]amino]ethanol chloride is sourced from PubChem (CID 53351738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).