C20H25ClN3O- — CID 53351898
N-(4-benzylpiperazin-1-yl)-1-(2-ethoxyphenyl)methanimine chloride (PubChem CID 53351898) has the molecular formula C20H25ClN3O- and a molecular weight of 358.89 g/mol. Its IUPAC name is N-(4-benzylpiperazin-1-yl)-1-(2-ethoxyphenyl)methanimine chloride.
| Compound Name | N-(4-benzylpiperazin-1-yl)-1-(2-ethoxyphenyl)methanimine chloride |
|---|---|
| PubChem CID | 53351898 |
| Molecular Formula | C20H25ClN3O- |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-(4-benzylpiperazin-1-yl)-1-(2-ethoxyphenyl)methanimine chloride |
| SMILES | CCOc1ccccc1C=NN1CCN(Cc2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C20H25N3O.ClH/c1-2-24-20-11-7-6-10-19(20)16-21-23-14-12-22(13-15-23)17-18-8-4-3-5-9-18;/h3-11,16H,2,12-15,17H2,1H3;1H/p-1 |
| InChIKey | VKDZIDTVKDODLT-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|