About 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride
3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride (PubChem CID 53352547) has the molecular formula C18H19ClN-
and a molecular weight of 284.81 g/mol. Its IUPAC name is 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride.
Molecular Properties
| Compound Name | 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride |
| PubChem CID | 53352547 |
| Molecular Formula | C18H19ClN- |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride |
| SMILES | CC1Cc2ccccc2C(CCc2ccccc2)=N1.[Cl-] |
| InChI | InChI=1S/C18H19N.ClH/c1-14-13-16-9-5-6-10-17(16)18(19-14)12-11-15-7-3-2-4-8-15;/h2-10,14H,11-13H2,1H3;1H/p-1 |
| InChIKey | LAORPZBQNFMXCZ-UHFFFAOYSA-M |
| XLogP | 1.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride?
The IUPAC name of 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride (CID 53352547) is 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride.
What is the SMILES notation for 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride?
The canonical SMILES for 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride is CC1Cc2ccccc2C(CCc2ccccc2)=N1.[Cl-].
What is the InChIKey of 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride?
The InChIKey is LAORPZBQNFMXCZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H19N.ClH/c1-14-13-16-9-5-6-10-17(16)18(19-14)12-11-15-7-3-2-4-8-15;/h2-10,14H,11-13H2,1H3;1H/p-1.
What are the key properties of 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride?
3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride has a molecular weight of 284.81 g/mol, XLogP of 1.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-(2-phenylethyl)-3,4-dihydroisoquinoline chloride is sourced from PubChem (CID 53352547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).