C11H14N4O2S2 — CID 53353129
6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazine-3-thione (PubChem CID 53353129) has the molecular formula C11H14N4O2S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazine-3-thione.
| Compound Name | 6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazine-3-thione |
|---|---|
| PubChem CID | 53353129 |
| Molecular Formula | C11H14N4O2S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 6-cyclohexylsulfonyl-2H-[1,2,4]triazolo[4,3-b]pyridazine-3-thione |
| SMILES | O=S(=O)(c1ccc2n[nH]c(=S)n2n1)C1CCCCC1 |
| InChI | InChI=1S/C11H14N4O2S2/c16-19(17,8-4-2-1-3-5-8)10-7-6-9-12-13-11(18)15(9)14-10/h6-8H,1-5H2,(H,13,18) |
| InChIKey | OBKZIAYTUDSTCA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|