C24H23ClFN5O2 — CID 53353151
(E)-4-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-2,5,6-trideuterio-4-fluoroanilino)-3-cyano-2,5,8-trideuterio-7-ethoxyquinolin-6-yl]-3-deuteriobut-2-enamide (PubChem CID 53353151) has the molecular formula C24H23ClFN5O2 and a molecular weight of 481.01 g/mol. Its IUPAC name is (E)-4-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-2,5,6-trideuterio-4-fluoroanilino)-3-cyano-2,5,8-trideuterio-7-ethoxyquinolin-6-yl]-3-deuteriobut-2-enamide.
| Compound Name | (E)-4-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-2,5,6-trideuterio-4-fluoroanilino)-3-cyano-2,5,8-trideuterio-7-ethoxyquinolin-6-yl]-3-deuteriobut-2-enamide |
|---|---|
| PubChem CID | 53353151 |
| Molecular Formula | C24H23ClFN5O2 |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | (E)-4-[bis(trideuteriomethyl)amino]-N-[4-(3-chloro-2,5,6-trideuterio-4-fluoroanilino)-3-cyano-2,5,8-trideuterio-7-ethoxyquinolin-6-yl]-3-deuteriobut-2-enamide |
| SMILES | [2H]/C(=C\C(=O)Nc1c(OCC)c([2H])c2nc([2H])c(C#N)c(Nc3c([2H])c([2H])c(F)c(Cl)c3[2H])c2c1[2H])CN(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C24H23ClFN5O2/c1-4-33-22-12-20-17(11-21(22)30-23(32)6-5-9-31(2)3)24(15(13-27)14-28-20)29-16-7-8-19(26)18(25)10-16/h5-8,10-12,14H,4,9H2,1-3H3,(H,28,29)(H,30,32)/b6-5+/i2D3,3D3,5D,7D,8D,10D,11D,12D,14D |
| InChIKey | WVUNYSQLFKLYNI-RWMFWGQVSA-N |
| XLogP | 5.10 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|