C15H16F3N5 — CID 53353230
5-phenyl-6-[3-(trifluoromethyl)piperidin-1-yl]-1,2,4-triazin-3-amine (PubChem CID 53353230) has the molecular formula C15H16F3N5 and a molecular weight of 323.32 g/mol. Its IUPAC name is 5-phenyl-6-[3-(trifluoromethyl)piperidin-1-yl]-1,2,4-triazin-3-amine.
| Compound Name | 5-phenyl-6-[3-(trifluoromethyl)piperidin-1-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 53353230 |
| Molecular Formula | C15H16F3N5 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 5-phenyl-6-[3-(trifluoromethyl)piperidin-1-yl]-1,2,4-triazin-3-amine |
| SMILES | Nc1nnc(N2CCCC(C(F)(F)F)C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H16F3N5/c16-15(17,18)11-7-4-8-23(9-11)13-12(20-14(19)22-21-13)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,19,20,22) |
| InChIKey | IYQQCTRBWVMSML-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |