C17H16N4 — CID 53353233
6-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazin-3-amine (PubChem CID 53353233) has the molecular formula C17H16N4 and a molecular weight of 276.34 g/mol. Its IUPAC name is 6-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazin-3-amine.
| Compound Name | 6-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 53353233 |
| Molecular Formula | C17H16N4 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 6-(3,4-dimethylphenyl)-5-phenyl-1,2,4-triazin-3-amine |
| SMILES | Cc1ccc(-c2nnc(N)nc2-c2ccccc2)cc1C |
| InChI | InChI=1S/C17H16N4/c1-11-8-9-14(10-12(11)2)16-15(19-17(18)21-20-16)13-6-4-3-5-7-13/h3-10H,1-2H3,(H2,18,19,21) |
| InChIKey | CYARAUSFBAIAGS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |